C27H48O4Si — CID 101217885
dimethyl (3E,4Z)-3-hexylidene-4-(1-triethylsilylhexylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 101217885) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is dimethyl (3E,4Z)-3-hexylidene-4-(1-triethylsilylhexylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3E,4Z)-3-hexylidene-4-(1-triethylsilylhexylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101217885 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | dimethyl (3E,4Z)-3-hexylidene-4-(1-triethylsilylhexylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CCCCC/C=C1\CC(C(=O)OC)(C(=O)OC)C\C1=C(/CCCCC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H48O4Si/c1-8-13-15-17-18-22-20-27(25(28)30-6,26(29)31-7)21-23(22)24(19-16-14-9-2)32(10-3,11-4)12-5/h18H,8-17,19-21H2,1-7H3/b22-18+,24-23- |
| InChIKey | WJZJRKRVSLVWED-XLGAHOKOSA-N |
| XLogP | 7.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|