C33H56O3 — CID 101218978
8-ethoxy-3,5,6-trimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,8,9,10-tetrahydro-1H-pyrano[3,2-f]chromene (PubChem CID 101218978) has the molecular formula C33H56O3 and a molecular weight of 500.81 g/mol. Its IUPAC name is 8-ethoxy-3,5,6-trimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,8,9,10-tetrahydro-1H-pyrano[3,2-f]chromene.
| Compound Name | 8-ethoxy-3,5,6-trimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,8,9,10-tetrahydro-1H-pyrano[3,2-f]chromene |
|---|---|
| PubChem CID | 101218978 |
| Molecular Formula | C33H56O3 |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 500.42 |
| IUPAC Name | 8-ethoxy-3,5,6-trimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,8,9,10-tetrahydro-1H-pyrano[3,2-f]chromene |
| SMILES | CCOC1CCc2c3c(c(C)c(C)c2O1)OC(C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC3 |
| InChI | InChI=1S/C33H56O3/c1-9-34-30-19-18-28-29-20-22-33(8,36-32(29)27(7)26(6)31(28)35-30)21-12-17-25(5)16-11-15-24(4)14-10-13-23(2)3/h23-25,30H,9-22H2,1-8H3/t24-,25-,30?,33?/m1/s1 |
| InChIKey | VCKDAQDTERNDNV-AVVQPCBPSA-N |
| XLogP | 9.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |