C22H22Cl3N3O10 — CID 101224526
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-[(1,3-dioxoisoindol-2-yl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 101224526) has the molecular formula C22H22Cl3N3O10 and a molecular weight of 594.79 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-[(1,3-dioxoisoindol-2-yl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-[(1,3-dioxoisoindol-2-yl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101224526 |
| Molecular Formula | C22H22Cl3N3O10 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 593.04 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-[(1,3-dioxoisoindol-2-yl)amino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NN1C(=O)c2ccccc2C1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H22Cl3N3O10/c1-9(29)34-8-14-16(35-10(2)30)17(36-11(3)31)15(20(37-14)38-21(26)22(23,24)25)27-28-18(32)12-6-4-5-7-13(12)19(28)33/h4-7,14-17,20,26-27H,8H2,1-3H3/b26-21+/t14-,15-,16-,17-,20+/m1/s1 |
| InChIKey | WEESBTFAPKKAMF-RLQZLQMJSA-N |
| XLogP | 1.67 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|