C23H22N2S3 — CID 101225413
2-(1-adamantyl)-4,6-dithiophen-2-yl-1H-thieno[3,4-d]imidazole (PubChem CID 101225413) has the molecular formula C23H22N2S3 and a molecular weight of 422.64 g/mol. Its IUPAC name is 2-(1-adamantyl)-4,6-dithiophen-2-yl-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-(1-adamantyl)-4,6-dithiophen-2-yl-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 101225413 |
| Molecular Formula | C23H22N2S3 |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-(1-adamantyl)-4,6-dithiophen-2-yl-1H-thieno[3,4-d]imidazole |
| SMILES | c1csc(-c2sc(-c3cccs3)c3[nH]c(C45CC6CC(CC(C6)C4)C5)nc23)c1 |
| InChI | InChI=1S/C23H22N2S3/c1-3-16(26-5-1)20-18-19(21(28-20)17-4-2-6-27-17)25-22(24-18)23-10-13-7-14(11-23)9-15(8-13)12-23/h1-6,13-15H,7-12H2,(H,24,25) |
| InChIKey | OVPNJGAWXRZREH-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |