C26H54O4Si3 — CID 101228909
(4S,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-triethylsilyloxyoct-2-ynal (PubChem CID 101228909) has the molecular formula C26H54O4Si3 and a molecular weight of 514.97 g/mol. Its IUPAC name is (4S,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-triethylsilyloxyoct-2-ynal.
| Compound Name | (4S,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-triethylsilyloxyoct-2-ynal |
|---|---|
| PubChem CID | 101228909 |
| Molecular Formula | C26H54O4Si3 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | (4S,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-triethylsilyloxyoct-2-ynal |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@@H](C#CC=O)O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O4Si3/c1-15-33(16-2,17-3)30-24(22(4)28-31(11,12)25(5,6)7)21-23(19-18-20-27)29-32(13,14)26(8,9)10/h20,22-24H,15-17,21H2,1-14H3/t22-,23+,24+/m0/s1 |
| InChIKey | CSKKEKHDMQQOMN-RBZQAINGSA-N |
| XLogP | 7.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|