C20H40O5Si2 — CID 101222018
(4S,5R,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxyoct-2-ynal (PubChem CID 101222018) has the molecular formula C20H40O5Si2 and a molecular weight of 416.71 g/mol. Its IUPAC name is (4S,5R,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxyoct-2-ynal.
| Compound Name | (4S,5R,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxyoct-2-ynal |
|---|---|
| PubChem CID | 101222018 |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (4S,5R,6R,7S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxyoct-2-ynal |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](C#CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si2/c1-15(24-26(8,9)19(2,3)4)17(22)18(23)16(13-12-14-21)25-27(10,11)20(5,6)7/h14-18,22-23H,1-11H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | FWABYCVACIYMOR-XSLAGTTESA-N |
| XLogP | 3.71 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|