C39H82O5Si5 — CID 11388638
(3S,5R,9S,11R)-3,9,11,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilyldodeca-1,7-diyn-5-ol (PubChem CID 11388638) has the molecular formula C39H82O5Si5 and a molecular weight of 771.51 g/mol. Its IUPAC name is (3S,5R,9S,11R)-3,9,11,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilyldodeca-1,7-diyn-5-ol.
| Compound Name | (3S,5R,9S,11R)-3,9,11,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilyldodeca-1,7-diyn-5-ol |
|---|---|
| PubChem CID | 11388638 |
| Molecular Formula | C39H82O5Si5 |
| Molecular Weight | 771.51 g/mol |
| Exact Mass | 770.50 |
| IUPAC Name | (3S,5R,9S,11R)-3,9,11,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilyldodeca-1,7-diyn-5-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](C[C@@H](C#CC[C@@H](O)C[C@@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H82O5Si5/c1-36(2,3)46(16,17)41-31-35(44-49(22,23)39(10,11)12)30-33(42-47(18,19)37(4,5)6)26-24-25-32(40)29-34(27-28-45(13,14)15)43-48(20,21)38(7,8)9/h32-35,40H,25,29-31H2,1-23H3/t32-,33-,34-,35-/m1/s1 |
| InChIKey | MIYOZUQJDBDWDY-BAQBVXSRSA-N |
| XLogP | 11.59 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.51 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|