C25H52O4Si2 — CID 10457543
(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]tridec-6-yne-2,3-diol (PubChem CID 10457543) has the molecular formula C25H52O4Si2 and a molecular weight of 472.86 g/mol. Its IUPAC name is (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]tridec-6-yne-2,3-diol.
| Compound Name | (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]tridec-6-yne-2,3-diol |
|---|---|
| PubChem CID | 10457543 |
| Molecular Formula | C25H52O4Si2 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]tridec-6-yne-2,3-diol |
| SMILES | CCCCCCC#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)C(C)O |
| InChI | InChI=1S/C25H52O4Si2/c1-13-14-15-16-17-18-19-21(28-30(9,10)24(3,4)5)23(22(27)20(2)26)29-31(11,12)25(6,7)8/h20-23,26-27H,13-17H2,1-12H3/t20?,21-,22?,23+/m0/s1 |
| InChIKey | AODQDTWGSQWBCL-NFJGTOLLSA-N |
| XLogP | 6.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|