C25H54O3Si3 — CID 11081434
[(1R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylpentoxy]-tert-butyl-dimethylsilane (PubChem CID 11081434) has the molecular formula C25H54O3Si3 and a molecular weight of 486.96 g/mol. Its IUPAC name is [(1R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylpentoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylpentoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11081434 |
| Molecular Formula | C25H54O3Si3 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | [(1R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylpentoxy]-tert-butyl-dimethylsilane |
| SMILES | C#C[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O3Si3/c1-18-21(27-30(14,15)24(6,7)8)19-22(28-31(16,17)25(9,10)11)20(2)26-29(12,13)23(3,4)5/h1,20-22H,19H2,2-17H3/t20-,21+,22-/m1/s1 |
| InChIKey | YLDDYRWODNECRF-BHIFYINESA-N |
| XLogP | 8.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|