C28H62O3Si4 — CID 101228908
[(3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-ynyl]-trimethylsilane (PubChem CID 101228908) has the molecular formula C28H62O3Si4 and a molecular weight of 559.15 g/mol. Its IUPAC name is [(3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-ynyl]-trimethylsilane.
| Compound Name | [(3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 101228908 |
| Molecular Formula | C28H62O3Si4 |
| Molecular Weight | 559.15 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | [(3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-ynyl]-trimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H62O3Si4/c1-18-35(19-2,20-3)31-26(24(4)29-33(14,15)27(5,6)7)23-25(21-22-32(11,12)13)30-34(16,17)28(8,9)10/h24-26H,18-20,23H2,1-17H3/t24-,25+,26+/m0/s1 |
| InChIKey | FRUYXAPTGADMHQ-JIMJEQGWSA-N |
| XLogP | 9.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.15 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|