C13H15N3 — CID 101229791
1-(4,6-dimethyl-2-pyridinyl)-2-phenylhydrazine (PubChem CID 101229791) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)-2-phenylhydrazine.
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)-2-phenylhydrazine |
|---|---|
| PubChem CID | 101229791 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)-2-phenylhydrazine |
| SMILES | Cc1cc(C)nc(NNc2ccccc2)c1 |
| InChI | InChI=1S/C13H15N3/c1-10-8-11(2)14-13(9-10)16-15-12-6-4-3-5-7-12/h3-9,15H,1-2H3,(H,14,16) |
| InChIKey | DBVVDYQHOQYVBQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|