C22H21NO5S — CID 101230383
(2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]-3-oxo-1-benzothiophene-7-carboxylic acid (PubChem CID 101230383) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]-3-oxo-1-benzothiophene-7-carboxylic acid.
| Compound Name | (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]-3-oxo-1-benzothiophene-7-carboxylic acid |
|---|---|
| PubChem CID | 101230383 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]-3-oxo-1-benzothiophene-7-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(/C=C2/Sc3c(C(=O)O)cccc3C2=O)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-22(2,3)28-21(27)23-12-14-9-7-13(8-10-14)11-17-18(24)15-5-4-6-16(20(25)26)19(15)29-17/h4-11H,12H2,1-3H3,(H,23,27)(H,25,26)/b17-11+ |
| InChIKey | GRSLBRVCRAFQFJ-GZTJUZNOSA-N |
| XLogP | 4.74 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|