C29H32O3S — CID 101231824
(1S)-1-[(2R,4aR,10bR)-4,4-dimethyl-7-phenylmethoxy-4a,5,6,10b-tetrahydrobenzo[h][1,3]benzoxathiin-2-yl]-1-phenylethanol (PubChem CID 101231824) has the molecular formula C29H32O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is (1S)-1-[(2R,4aR,10bR)-4,4-dimethyl-7-phenylmethoxy-4a,5,6,10b-tetrahydrobenzo[h][1,3]benzoxathiin-2-yl]-1-phenylethanol.
| Compound Name | (1S)-1-[(2R,4aR,10bR)-4,4-dimethyl-7-phenylmethoxy-4a,5,6,10b-tetrahydrobenzo[h][1,3]benzoxathiin-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 101231824 |
| Molecular Formula | C29H32O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (1S)-1-[(2R,4aR,10bR)-4,4-dimethyl-7-phenylmethoxy-4a,5,6,10b-tetrahydrobenzo[h][1,3]benzoxathiin-2-yl]-1-phenylethanol |
| SMILES | CC1(C)S[C@H]([C@@](C)(O)c2ccccc2)O[C@H]2c3cccc(OCc4ccccc4)c3CC[C@H]21 |
| InChI | InChI=1S/C29H32O3S/c1-28(2)24-18-17-22-23(15-10-16-25(22)31-19-20-11-6-4-7-12-20)26(24)32-27(33-28)29(3,30)21-13-8-5-9-14-21/h4-16,24,26-27,30H,17-19H2,1-3H3/t24-,26+,27-,29+/m1/s1 |
| InChIKey | BBBDAZTWPIQBRK-RFIFTVQCSA-N |
| XLogP | 6.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |