C27H33F3N6O6 — CID 101236531
(2S)-2-[[(2S)-2-[[(2S)-2-benzyl-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 101236531) has the molecular formula C27H33F3N6O6 and a molecular weight of 594.59 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-benzyl-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-benzyl-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 101236531 |
| Molecular Formula | C27H33F3N6O6 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-benzyl-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | C[C@H](NC(=O)[C@](Cc1ccccc1)(NC(=O)OCc1ccccc1)C(F)(F)F)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H33F3N6O6/c1-17(21(37)35-20(22(38)39)13-8-14-33-24(31)32)34-23(40)26(27(28,29)30,15-18-9-4-2-5-10-18)36-25(41)42-16-19-11-6-3-7-12-19/h2-7,9-12,17,20H,8,13-16H2,1H3,(H,34,40)(H,35,37)(H,36,41)(H,38,39)(H4,31,32,33)/t17-,20-,26-/m0/s1 |
| InChIKey | HEYIXNACLOBMAH-SZCFDOLESA-N |
| XLogP | 1.58 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|