C21H30F2N6O6 — CID 10962147
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[3,3-difluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]pentanoic acid (PubChem CID 10962147) has the molecular formula C21H30F2N6O6 and a molecular weight of 500.50 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[3,3-difluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[3,3-difluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10962147 |
| Molecular Formula | C21H30F2N6O6 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[3,3-difluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]pentanoic acid |
| SMILES | C[C@H](NC(=O)C(C)(NC(=O)OCc1ccccc1)C(F)F)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H30F2N6O6/c1-12(15(30)28-14(16(31)32)9-6-10-26-19(24)25)27-18(33)21(2,17(22)23)29-20(34)35-11-13-7-4-3-5-8-13/h3-5,7-8,12,14,17H,6,9-11H2,1-2H3,(H,27,33)(H,28,30)(H,29,34)(H,31,32)(H4,24,25,26)/t12-,14-,21?/m0/s1 |
| InChIKey | ZPOBHCAVDDYYJJ-WDPCJFHJSA-N |
| XLogP | 0.06 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|