C18H24O8 — CID 101237354
[(2R,3S,4aS,8aR)-3,4a,8a-triacetyloxy-1,2,3,4,5,8-hexahydronaphthalen-2-yl] acetate (PubChem CID 101237354) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is [(2R,3S,4aS,8aR)-3,4a,8a-triacetyloxy-1,2,3,4,5,8-hexahydronaphthalen-2-yl] acetate.
| Compound Name | [(2R,3S,4aS,8aR)-3,4a,8a-triacetyloxy-1,2,3,4,5,8-hexahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 101237354 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(2R,3S,4aS,8aR)-3,4a,8a-triacetyloxy-1,2,3,4,5,8-hexahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(OC(C)=O)CC=CC[C@@]2(OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H24O8/c1-11(19)23-15-9-17(25-13(3)21)7-5-6-8-18(17,26-14(4)22)10-16(15)24-12(2)20/h5-6,15-16H,7-10H2,1-4H3/t15-,16+,17-,18+ |
| InChIKey | FXQFVKZRAZNDRC-USTZCAOPSA-N |
| XLogP | 1.60 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|