C14H20Br2O6 — CID 101237346
[(2S,3R,4aR,6S,7S,8aR)-3-acetyloxy-6,7-dibromo-4a,8a-dihydroxy-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate (PubChem CID 101237346) has the molecular formula C14H20Br2O6 and a molecular weight of 444.12 g/mol. Its IUPAC name is [(2S,3R,4aR,6S,7S,8aR)-3-acetyloxy-6,7-dibromo-4a,8a-dihydroxy-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate.
| Compound Name | [(2S,3R,4aR,6S,7S,8aR)-3-acetyloxy-6,7-dibromo-4a,8a-dihydroxy-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 101237346 |
| Molecular Formula | C14H20Br2O6 |
| Molecular Weight | 444.12 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | [(2S,3R,4aR,6S,7S,8aR)-3-acetyloxy-6,7-dibromo-4a,8a-dihydroxy-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(O)C[C@H](Br)[C@@H](Br)C[C@]2(O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H20Br2O6/c1-7(17)21-11-5-13(19)3-9(15)10(16)4-14(13,20)6-12(11)22-8(2)18/h9-12,19-20H,3-6H2,1-2H3/t9-,10-,11-,12+,13-,14-/m0/s1 |
| InChIKey | LAQXVMAOHBCMID-GAURVVSWSA-N |
| XLogP | 1.43 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|