C13H23N4O11P — CID 101239646
[3-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]imino]-2-hydroxybutyl] dihydrogen phosphate (PubChem CID 101239646) has the molecular formula C13H23N4O11P and a molecular weight of 442.32 g/mol. Its IUPAC name is [3-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]imino]-2-hydroxybutyl] dihydrogen phosphate.
| Compound Name | [3-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]imino]-2-hydroxybutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101239646 |
| Molecular Formula | C13H23N4O11P |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [3-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]imino]-2-hydroxybutyl] dihydrogen phosphate |
| SMILES | C/C(=N\c1c(NC[C@H](O)[C@H](O)[C@H](O)CO)[nH]c(=O)[nH]c1=O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C13H23N4O11P/c1-5(8(21)4-28-29(25,26)27)15-9-11(16-13(24)17-12(9)23)14-2-6(19)10(22)7(20)3-18/h6-8,10,18-22H,2-4H2,1H3,(H2,25,26,27)(H3,14,16,17,23,24)/b15-5+/t6-,7+,8?,10-/m0/s1 |
| InChIKey | HWIMKEZMTUMANU-IGKYDUBQSA-N |
| XLogP | -3.89 |
| TPSA | 258.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|