C32H60N2O4 — CID 101239741
bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3R)-2,3-bis(tert-butylamino)butanedioate (PubChem CID 101239741) has the molecular formula C32H60N2O4 and a molecular weight of 536.84 g/mol. Its IUPAC name is bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3R)-2,3-bis(tert-butylamino)butanedioate.
| Compound Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3R)-2,3-bis(tert-butylamino)butanedioate |
|---|---|
| PubChem CID | 101239741 |
| Molecular Formula | C32H60N2O4 |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 536.46 |
| IUPAC Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3R)-2,3-bis(tert-butylamino)butanedioate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@H](NC(C)(C)C)[C@@H](NC(C)(C)C)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C32H60N2O4/c1-19(2)23-15-13-21(5)17-25(23)37-29(35)27(33-31(7,8)9)28(34-32(10,11)12)30(36)38-26-18-22(6)14-16-24(26)20(3)4/h19-28,33-34H,13-18H2,1-12H3/t21-,22-,23+,24+,25-,26-,27-,28-/m1/s1 |
| InChIKey | AFFHPEOQPBRULC-YNMRTIPJSA-N |
| XLogP | 6.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |