C16H31O2P — CID 134985043
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] [tert-butyl(methyl)phosphanyl]formate (PubChem CID 134985043) has the molecular formula C16H31O2P and a molecular weight of 286.40 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] [tert-butyl(methyl)phosphanyl]formate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] [tert-butyl(methyl)phosphanyl]formate |
|---|---|
| PubChem CID | 134985043 |
| Molecular Formula | C16H31O2P |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] [tert-butyl(methyl)phosphanyl]formate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)P(C)C(C)(C)C |
| InChI | InChI=1S/C16H31O2P/c1-11(2)13-9-8-12(3)10-14(13)18-15(17)19(7)16(4,5)6/h11-14H,8-10H2,1-7H3/t12-,13+,14-,19?/m0/s1 |
| InChIKey | JUWNREHCQZEZGW-IAYSQTMDSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|