C10H8N4 — CID 101240321
[4-cyanoimino-2,6-bis(deuteriomethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 101240321) has the molecular formula C10H8N4 and a molecular weight of 186.21 g/mol. Its IUPAC name is [4-cyanoimino-2,6-bis(deuteriomethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [4-cyanoimino-2,6-bis(deuteriomethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 101240321 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | [4-cyanoimino-2,6-bis(deuteriomethyl)cyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | [2H]CC1=CC(=NC#N)C=C(C[2H])C1=NC#N |
| InChI | InChI=1S/C10H8N4/c1-7-3-9(13-5-11)4-8(2)10(7)14-6-12/h3-4H,1-2H3/b13-9-,14-10+/i1D,2D |
| InChIKey | GXWQDULYNYQQAF-MVTRBVPISA-N |
| XLogP | 1.74 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|