C24H27N3O3 — CID 101243191
tert-butyl N-[(E,2S)-1-phenyl-5-phthalazin-1-yloxypent-3-en-2-yl]carbamate (PubChem CID 101243191) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-1-phenyl-5-phthalazin-1-yloxypent-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-1-phenyl-5-phthalazin-1-yloxypent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 101243191 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl N-[(E,2S)-1-phenyl-5-phthalazin-1-yloxypent-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/COc1nncc2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C24H27N3O3/c1-24(2,3)30-23(28)26-20(16-18-10-5-4-6-11-18)13-9-15-29-22-21-14-8-7-12-19(21)17-25-27-22/h4-14,17,20H,15-16H2,1-3H3,(H,26,28)/b13-9+/t20-/m1/s1 |
| InChIKey | YFBPDSXZMKHUTM-CWUFLNSKSA-N |
| XLogP | 4.70 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|