C29H32N2O5S — CID 101243319
[(E)-4-[benzyl-[(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]but-2-enyl] acetate (PubChem CID 101243319) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is [(E)-4-[benzyl-[(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]but-2-enyl] acetate.
| Compound Name | [(E)-4-[benzyl-[(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]but-2-enyl] acetate |
|---|---|
| PubChem CID | 101243319 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [(E)-4-[benzyl-[(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]but-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/CN(Cc1ccccc1)C(=O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H32N2O5S/c1-23-15-17-27(18-16-23)37(34,35)30-28(21-25-11-5-3-6-12-25)29(33)31(19-9-10-20-36-24(2)32)22-26-13-7-4-8-14-26/h3-18,28,30H,19-22H2,1-2H3/b10-9+/t28-/m0/s1 |
| InChIKey | SMDNYLDYUYGCIO-MIHSOZJOSA-N |
| XLogP | 4.03 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|