About 2-(butyldisulfanyl)ethyl benzoate
2-(butyldisulfanyl)ethyl benzoate (PubChem CID 101248651) has the molecular formula C13H18O2S2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-(butyldisulfanyl)ethyl benzoate.
Molecular Properties
| Compound Name | 2-(butyldisulfanyl)ethyl benzoate |
| PubChem CID | 101248651 |
| Molecular Formula | C13H18O2S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(butyldisulfanyl)ethyl benzoate |
| SMILES | CCCCSSCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2S2/c1-2-3-10-16-17-11-9-15-13(14)12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3 |
| InChIKey | AKPWMRCQOWAOBA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(butyldisulfanyl)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butyldisulfanyl)ethyl benzoate?
The IUPAC name of 2-(butyldisulfanyl)ethyl benzoate (CID 101248651) is 2-(butyldisulfanyl)ethyl benzoate.
What is the SMILES notation for 2-(butyldisulfanyl)ethyl benzoate?
The canonical SMILES for 2-(butyldisulfanyl)ethyl benzoate is CCCCSSCCOC(=O)c1ccccc1.
What is the InChIKey of 2-(butyldisulfanyl)ethyl benzoate?
The InChIKey is AKPWMRCQOWAOBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S2/c1-2-3-10-16-17-11-9-15-13(14)12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3.
What are the key properties of 2-(butyldisulfanyl)ethyl benzoate?
2-(butyldisulfanyl)ethyl benzoate has a molecular weight of 270.42 g/mol, XLogP of 4.02, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butyldisulfanyl)ethyl benzoate is sourced from PubChem (CID 101248651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).