C24H24F6N2O — CID 101252838
(4aS,6R,8aS)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-6-phenyl-2,3,4,4a,5,8a-hexahydro-1H-1,7-naphthyridine (PubChem CID 101252838) has the molecular formula C24H24F6N2O and a molecular weight of 470.46 g/mol. Its IUPAC name is (4aS,6R,8aS)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-6-phenyl-2,3,4,4a,5,8a-hexahydro-1H-1,7-naphthyridine.
| Compound Name | (4aS,6R,8aS)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-6-phenyl-2,3,4,4a,5,8a-hexahydro-1H-1,7-naphthyridine |
|---|---|
| PubChem CID | 101252838 |
| Molecular Formula | C24H24F6N2O |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (4aS,6R,8aS)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-6-phenyl-2,3,4,4a,5,8a-hexahydro-1H-1,7-naphthyridine |
| SMILES | FC(F)(F)c1cc(COC[C@]2(c3ccccc3)C[C@@H]3CCCN[C@@H]3C=N2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H24F6N2O/c25-23(26,27)19-9-16(10-20(11-19)24(28,29)30)14-33-15-22(18-6-2-1-3-7-18)12-17-5-4-8-31-21(17)13-32-22/h1-3,6-7,9-11,13,17,21,31H,4-5,8,12,14-15H2/t17-,21+,22-/m0/s1 |
| InChIKey | QBKDIEKHJNANJB-WTOYTKOKSA-N |
| XLogP | 5.98 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |