C15H20O — CID 101253837
(1S,2S,4Z,5S,6S,7R)-5-methyl-4-(2-methylpropylidene)tricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 101253837) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1S,2S,4Z,5S,6S,7R)-5-methyl-4-(2-methylpropylidene)tricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2S,4Z,5S,6S,7R)-5-methyl-4-(2-methylpropylidene)tricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 101253837 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1S,2S,4Z,5S,6S,7R)-5-methyl-4-(2-methylpropylidene)tricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC(C)/C=C1\C(=O)[C@@H]2[C@H]([C@@H]1C)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H20O/c1-8(2)6-12-9(3)13-10-4-5-11(7-10)14(13)15(12)16/h4-6,8-11,13-14H,7H2,1-3H3/b12-6-/t9-,10+,11-,13-,14+/m1/s1 |
| InChIKey | OFSCECAVLVXCLD-BVJYOZJOSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|