C59H116O8S2 — CID 101257224
2-[2-[2-[2-[(2R)-2,3-bis[(3S,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate (PubChem CID 101257224) has the molecular formula C59H116O8S2 and a molecular weight of 1017.70 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2R)-2,3-bis[(3S,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate.
| Compound Name | 2-[2-[2-[2-[(2R)-2,3-bis[(3S,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 101257224 |
| Molecular Formula | C59H116O8S2 |
| Molecular Weight | 1017.70 g/mol |
| Exact Mass | 1016.81 |
| IUPAC Name | 2-[2-[2-[2-[(2R)-2,3-bis[(3S,7R,11R)-3,7,11,15-tetramethylhexadecoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@H](C)CCOC[C@H](COCCOCCOCCOCCOC(=O)CCCC[C@@H]1CCSS1)OCC[C@@H](C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C59H116O8S2/c1-49(2)19-13-21-51(5)23-15-25-53(7)27-17-29-55(9)33-36-64-47-57(66-37-34-56(10)30-18-28-54(8)26-16-24-52(6)22-14-20-50(3)4)48-65-43-42-62-39-38-61-40-41-63-44-45-67-59(60)32-12-11-31-58-35-46-68-69-58/h49-58H,11-48H2,1-10H3/t51-,52-,53-,54-,55+,56+,57-,58-/m1/s1 |
| InChIKey | GOMXGADFXPGZRX-XLESBBBTSA-N |
| XLogP | 16.64 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.70 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|