C19H29NO2S2Si — CID 101257345
(2R,3R)-2-methyl-3-phenyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)-3-triethylsilyloxypropan-1-one (PubChem CID 101257345) has the molecular formula C19H29NO2S2Si and a molecular weight of 395.67 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-phenyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)-3-triethylsilyloxypropan-1-one.
| Compound Name | (2R,3R)-2-methyl-3-phenyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)-3-triethylsilyloxypropan-1-one |
|---|---|
| PubChem CID | 101257345 |
| Molecular Formula | C19H29NO2S2Si |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (2R,3R)-2-methyl-3-phenyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)-3-triethylsilyloxypropan-1-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](c1ccccc1)[C@@H](C)C(=O)N1CCSC1=S |
| InChI | InChI=1S/C19H29NO2S2Si/c1-5-25(6-2,7-3)22-17(16-11-9-8-10-12-16)15(4)18(21)20-13-14-24-19(20)23/h8-12,15,17H,5-7,13-14H2,1-4H3/t15-,17-/m1/s1 |
| InChIKey | MPPVNVVJVASYAD-NVXWUHKLSA-N |
| XLogP | 5.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|