C24H31NSi — CID 101257472
[(3E)-3-[(1R,3S,5R)-6,6-dimethyl-3-(1-methylindol-3-yl)-2-bicyclo[3.1.1]heptanylidene]prop-1-ynyl]-trimethylsilane (PubChem CID 101257472) has the molecular formula C24H31NSi and a molecular weight of 361.61 g/mol. Its IUPAC name is [(3E)-3-[(1R,3S,5R)-6,6-dimethyl-3-(1-methylindol-3-yl)-2-bicyclo[3.1.1]heptanylidene]prop-1-ynyl]-trimethylsilane.
| Compound Name | [(3E)-3-[(1R,3S,5R)-6,6-dimethyl-3-(1-methylindol-3-yl)-2-bicyclo[3.1.1]heptanylidene]prop-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 101257472 |
| Molecular Formula | C24H31NSi |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | [(3E)-3-[(1R,3S,5R)-6,6-dimethyl-3-(1-methylindol-3-yl)-2-bicyclo[3.1.1]heptanylidene]prop-1-ynyl]-trimethylsilane |
| SMILES | Cn1cc([C@H]2C[C@H]3C[C@@H](/C2=C\C#C[Si](C)(C)C)C3(C)C)c2ccccc21 |
| InChI | InChI=1S/C24H31NSi/c1-24(2)17-14-20(18(22(24)15-17)11-9-13-26(4,5)6)21-16-25(3)23-12-8-7-10-19(21)23/h7-8,10-12,16-17,20,22H,14-15H2,1-6H3/b18-11-/t17-,20-,22-/m0/s1 |
| InChIKey | YYFQXLMSFMMGBL-XKOZXLOOSA-N |
| XLogP | 6.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|