C28H28ClNO2 — CID 101259391
tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(3-chlorophenyl)pent-4-enoate (PubChem CID 101259391) has the molecular formula C28H28ClNO2 and a molecular weight of 445.99 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(3-chlorophenyl)pent-4-enoate.
| Compound Name | tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(3-chlorophenyl)pent-4-enoate |
|---|---|
| PubChem CID | 101259391 |
| Molecular Formula | C28H28ClNO2 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(3-chlorophenyl)pent-4-enoate |
| SMILES | C=C[C@@H](c1cccc(Cl)c1)[C@@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H28ClNO2/c1-5-24(22-17-12-18-23(29)19-22)26(27(31)32-28(2,3)4)30-25(20-13-8-6-9-14-20)21-15-10-7-11-16-21/h5-19,24,26H,1H2,2-4H3/t24-,26+/m0/s1 |
| InChIKey | SMKUVNRTGBHLGM-AZGAKELHSA-N |
| XLogP | 6.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|