C33H39NO3 — CID 164670722
tert-butyl (2S,3S)-2-(benzhydrylideneamino)-3-ethenyl-7-phenylmethoxyheptanoate (PubChem CID 164670722) has the molecular formula C33H39NO3 and a molecular weight of 497.68 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-(benzhydrylideneamino)-3-ethenyl-7-phenylmethoxyheptanoate.
| Compound Name | tert-butyl (2S,3S)-2-(benzhydrylideneamino)-3-ethenyl-7-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 164670722 |
| Molecular Formula | C33H39NO3 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | tert-butyl (2S,3S)-2-(benzhydrylideneamino)-3-ethenyl-7-phenylmethoxyheptanoate |
| SMILES | C=C[C@H](CCCCOCc1ccccc1)[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H39NO3/c1-5-27(19-15-16-24-36-25-26-17-9-6-10-18-26)31(32(35)37-33(2,3)4)34-30(28-20-11-7-12-21-28)29-22-13-8-14-23-29/h5-14,17-18,20-23,27,31H,1,15-16,19,24-25H2,2-4H3/t27-,31+/m1/s1 |
| InChIKey | BLIYRUSGEDGFQH-JOMNFKBKSA-N |
| XLogP | 7.42 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|