C40H48O9 — CID 101261998
(2R,3S,4R,6R)-6-[4-[(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furan-2-yl]-3,4-dimethoxy-2-(methoxymethyl)oxane (PubChem CID 101261998) has the molecular formula C40H48O9 and a molecular weight of 672.82 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-[4-[(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furan-2-yl]-3,4-dimethoxy-2-(methoxymethyl)oxane.
| Compound Name | (2R,3S,4R,6R)-6-[4-[(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furan-2-yl]-3,4-dimethoxy-2-(methoxymethyl)oxane |
|---|---|
| PubChem CID | 101261998 |
| Molecular Formula | C40H48O9 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | (2R,3S,4R,6R)-6-[4-[(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furan-2-yl]-3,4-dimethoxy-2-(methoxymethyl)oxane |
| SMILES | COC[C@H]1O[C@@H](c2cc(C3C[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@@H](COCc4ccccc4)O3)co2)C[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C40H48O9/c1-41-26-37-39(43-3)35(42-2)21-34(49-37)33-19-31(25-46-33)32-20-36(45-23-29-15-9-5-10-16-29)40(47-24-30-17-11-6-12-18-30)38(48-32)27-44-22-28-13-7-4-8-14-28/h4-19,25,32,34-40H,20-24,26-27H2,1-3H3/t32?,34-,35-,36-,37-,38-,39+,40+/m1/s1 |
| InChIKey | IHIGAIFUZDBHRT-FXEKSBISSA-N |
| XLogP | 7.00 |
| TPSA | 86.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |