C22H23O6P — CID 101262269
[(2R,3S,4S)-3-acetyloxy-4-diphenylphosphoryl-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101262269) has the molecular formula C22H23O6P and a molecular weight of 414.39 g/mol. Its IUPAC name is [(2R,3S,4S)-3-acetyloxy-4-diphenylphosphoryl-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-3-acetyloxy-4-diphenylphosphoryl-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101262269 |
| Molecular Formula | C22H23O6P |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [(2R,3S,4S)-3-acetyloxy-4-diphenylphosphoryl-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC=C[C@H](P(=O)(c2ccccc2)c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H23O6P/c1-16(23)27-15-20-22(28-17(2)24)21(13-14-26-20)29(25,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,20-22H,15H2,1-2H3/t20-,21+,22+/m1/s1 |
| InChIKey | SFCZQYMTOFFNIA-FSSWDIPSSA-N |
| XLogP | 2.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|