C22H23NO6S — CID 101263515
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)sulfonyl-2H-quinoline-3-carbaldehyde (PubChem CID 101263515) has the molecular formula C22H23NO6S and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)sulfonyl-2H-quinoline-3-carbaldehyde.
| Compound Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)sulfonyl-2H-quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 101263515 |
| Molecular Formula | C22H23NO6S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)sulfonyl-2H-quinoline-3-carbaldehyde |
| SMILES | COc1ccc(S(=O)(=O)N2c3ccccc3C=C(C=O)C2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H23NO6S/c1-22(2)28-14-20(29-22)21-16(13-24)12-15-6-4-5-7-19(15)23(21)30(25,26)18-10-8-17(27-3)9-11-18/h4-13,20-21H,14H2,1-3H3/t20-,21?/m1/s1 |
| InChIKey | CYWFILJHJGFZKC-VQCQRNETSA-N |
| XLogP | 3.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|