C37H52O6SSi2 — CID 101267919
tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane (PubChem CID 101267919) has the molecular formula C37H52O6SSi2 and a molecular weight of 681.06 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101267919 |
| Molecular Formula | C37H52O6SSi2 |
| Molecular Weight | 681.06 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | tert-butyl-[[(2S,3R)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)[C@@]2(C[C@H]3OCCC[C@]3(C)O[Si](C)(C)C)O[C@@]2(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H52O6SSi2/c1-29-21-23-30(24-22-29)44(38,39)37(27-33-35(5,25-16-26-40-33)43-45(7,8)9)36(6,42-37)28-41-46(34(2,3)4,31-17-12-10-13-18-31)32-19-14-11-15-20-32/h10-15,17-24,33H,16,25-28H2,1-9H3/t33-,35+,36+,37-/m1/s1 |
| InChIKey | JDQPVYXRKHLGDQ-VNFJPAQBSA-N |
| XLogP | 7.01 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.06 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|