C42H39NO4 — CID 101272462
2-methyl-12,12,16,16-tetrakis(4-methylphenyl)-13,14,15-trioxa-2-azatetracyclo[8.4.3.01,10.03,8]heptadeca-3,5,7-trien-9-one (PubChem CID 101272462) has the molecular formula C42H39NO4 and a molecular weight of 621.78 g/mol. Its IUPAC name is 2-methyl-12,12,16,16-tetrakis(4-methylphenyl)-13,14,15-trioxa-2-azatetracyclo[8.4.3.01,10.03,8]heptadeca-3,5,7-trien-9-one.
| Compound Name | 2-methyl-12,12,16,16-tetrakis(4-methylphenyl)-13,14,15-trioxa-2-azatetracyclo[8.4.3.01,10.03,8]heptadeca-3,5,7-trien-9-one |
|---|---|
| PubChem CID | 101272462 |
| Molecular Formula | C42H39NO4 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | 2-methyl-12,12,16,16-tetrakis(4-methylphenyl)-13,14,15-trioxa-2-azatetracyclo[8.4.3.01,10.03,8]heptadeca-3,5,7-trien-9-one |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)CC34CC(c5ccc(C)cc5)(c5ccc(C)cc5)OC3(OO2)N(C)c2ccccc2C4=O)cc1 |
| InChI | InChI=1S/C42H39NO4/c1-28-10-18-32(19-11-28)40(33-20-12-29(2)13-21-33)26-39-27-41(34-22-14-30(3)15-23-34,35-24-16-31(4)17-25-35)46-47-42(39,45-40)43(5)37-9-7-6-8-36(37)38(39)44/h6-25H,26-27H2,1-5H3 |
| InChIKey | KYEUXGRNQZGZSR-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|