C37H38O6 — CID 14983165
3,3,12,12-tetrakis(4-methylphenyl)-4,5,10,11-tetraoxatricyclo[7.4.0.01,6]tridecane-6,9-diol (PubChem CID 14983165) has the molecular formula C37H38O6 and a molecular weight of 578.70 g/mol. Its IUPAC name is 3,3,12,12-tetrakis(4-methylphenyl)-4,5,10,11-tetraoxatricyclo[7.4.0.01,6]tridecane-6,9-diol.
| Compound Name | 3,3,12,12-tetrakis(4-methylphenyl)-4,5,10,11-tetraoxatricyclo[7.4.0.01,6]tridecane-6,9-diol |
|---|---|
| PubChem CID | 14983165 |
| Molecular Formula | C37H38O6 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 3,3,12,12-tetrakis(4-methylphenyl)-4,5,10,11-tetraoxatricyclo[7.4.0.01,6]tridecane-6,9-diol |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)CC34CC(c5ccc(C)cc5)(c5ccc(C)cc5)OOC3(O)CCC4(O)OO2)cc1 |
| InChI | InChI=1S/C37H38O6/c1-25-5-13-29(14-6-25)34(30-15-7-26(2)8-16-30)23-33-24-35(31-17-9-27(3)10-18-31,32-19-11-28(4)12-20-32)41-43-37(33,39)22-21-36(33,38)42-40-34/h5-20,38-39H,21-24H2,1-4H3 |
| InChIKey | LGATVQMVURNGPN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|