C17H15BrO2 — CID 101273827
(2S,4S,6R)-4-(bromomethyl)-3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene (PubChem CID 101273827) has the molecular formula C17H15BrO2 and a molecular weight of 331.21 g/mol. Its IUPAC name is (2S,4S,6R)-4-(bromomethyl)-3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene.
| Compound Name | (2S,4S,6R)-4-(bromomethyl)-3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene |
|---|---|
| PubChem CID | 101273827 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | (2S,4S,6R)-4-(bromomethyl)-3,13-dioxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene |
| SMILES | BrC[C@@H]1C[C@@H]2c3ccccc3Oc3ccccc3[C@H]2O1 |
| InChI | InChI=1S/C17H15BrO2/c18-10-11-9-14-12-5-1-3-7-15(12)20-16-8-4-2-6-13(16)17(14)19-11/h1-8,11,14,17H,9-10H2/t11-,14+,17+/m0/s1 |
| InChIKey | BKZZISQFVHURMI-FABXCBLPSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|