C28H26N2O2 — CID 101274208
N,2-dibenzyl-3-oxospiro[1H-isoquinoline-4,3'-cyclopentene]-1-carboxamide (PubChem CID 101274208) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N,2-dibenzyl-3-oxospiro[1H-isoquinoline-4,3'-cyclopentene]-1-carboxamide.
| Compound Name | N,2-dibenzyl-3-oxospiro[1H-isoquinoline-4,3'-cyclopentene]-1-carboxamide |
|---|---|
| PubChem CID | 101274208 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N,2-dibenzyl-3-oxospiro[1H-isoquinoline-4,3'-cyclopentene]-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1c2ccccc2C2(C=CCC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2O2/c31-26(29-19-21-11-3-1-4-12-21)25-23-15-7-8-16-24(23)28(17-9-10-18-28)27(32)30(25)20-22-13-5-2-6-14-22/h1-9,11-17,25H,10,18-20H2,(H,29,31) |
| InChIKey | JHEKJVLSTDERCC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|