C33H43NO3 — CID 101274521
(2S,6R)-2,6-diethyl-1-(1-phenylethoxy)-2,6-bis(phenylmethoxymethyl)piperidine (PubChem CID 101274521) has the molecular formula C33H43NO3 and a molecular weight of 501.71 g/mol. Its IUPAC name is (2S,6R)-2,6-diethyl-1-(1-phenylethoxy)-2,6-bis(phenylmethoxymethyl)piperidine.
| Compound Name | (2S,6R)-2,6-diethyl-1-(1-phenylethoxy)-2,6-bis(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 101274521 |
| Molecular Formula | C33H43NO3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | (2S,6R)-2,6-diethyl-1-(1-phenylethoxy)-2,6-bis(phenylmethoxymethyl)piperidine |
| SMILES | CC[C@@]1(COCc2ccccc2)CCC[C@](CC)(COCc2ccccc2)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C33H43NO3/c1-4-32(26-35-24-29-16-9-6-10-17-29)22-15-23-33(5-2,27-36-25-30-18-11-7-12-19-30)34(32)37-28(3)31-20-13-8-14-21-31/h6-14,16-21,28H,4-5,15,22-27H2,1-3H3/t28?,32-,33+ |
| InChIKey | CMQMVAWDNQUQGW-LSJGRHKYSA-N |
| XLogP | 7.90 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |