C22H30F3N5O2 — CID 10127556
(5S)-5-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]butyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one (PubChem CID 10127556) has the molecular formula C22H30F3N5O2 and a molecular weight of 453.51 g/mol. Its IUPAC name is (5S)-5-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]butyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]butyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10127556 |
| Molecular Formula | C22H30F3N5O2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | (5S)-5-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]butyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CC[C@@H](O)Cc2cccc(C(F)(F)F)c2)N1CCCCCCc1nn[nH]n1 |
| InChI | InChI=1S/C22H30F3N5O2/c23-22(24,25)17-7-5-6-16(14-17)15-19(31)11-9-18-10-12-21(32)30(18)13-4-2-1-3-8-20-26-28-29-27-20/h5-7,14,18-19,31H,1-4,8-13,15H2,(H,26,27,28,29)/t18-,19+/m0/s1 |
| InChIKey | SFUNHMMFTXMXED-RBUKOAKNSA-N |
| XLogP | 3.70 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|