C21H42NO3+ — CID 101276781
2-carboxyethyl-[(Z)-2-hydroxyoct-2-enyl]-dipentylazanium (PubChem CID 101276781) has the molecular formula C21H42NO3+ and a molecular weight of 356.57 g/mol. Its IUPAC name is 2-carboxyethyl-[(Z)-2-hydroxyoct-2-enyl]-dipentylazanium.
| Compound Name | 2-carboxyethyl-[(Z)-2-hydroxyoct-2-enyl]-dipentylazanium |
|---|---|
| PubChem CID | 101276781 |
| Molecular Formula | C21H42NO3+ |
| Molecular Weight | 356.57 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | 2-carboxyethyl-[(Z)-2-hydroxyoct-2-enyl]-dipentylazanium |
| SMILES | CCCCC/C=C(\O)C[N+](CCCCC)(CCCCC)CCC(=O)O |
| InChI | InChI=1S/C21H41NO3/c1-4-7-10-11-14-20(23)19-22(16-12-8-5-2,17-13-9-6-3)18-15-21(24)25/h14H,4-13,15-19H2,1-3H3,(H-,23,24,25)/p+1/b20-14- |
| InChIKey | FPMPOQUMFQYVML-ZHZULCJRSA-O |
| XLogP | 5.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|