C20H39NO3 — CID 177383693
4-[dibutyl-[(Z)-2-hydroxyoct-2-enyl]azaniumyl]butanoate (PubChem CID 177383693) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 4-[dibutyl-[(Z)-2-hydroxyoct-2-enyl]azaniumyl]butanoate.
| Compound Name | 4-[dibutyl-[(Z)-2-hydroxyoct-2-enyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 177383693 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | 4-[dibutyl-[(Z)-2-hydroxyoct-2-enyl]azaniumyl]butanoate |
| SMILES | CCCCC/C=C(\O)C[N+](CCCC)(CCCC)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H39NO3/c1-4-7-10-11-13-19(22)18-21(15-8-5-2,16-9-6-3)17-12-14-20(23)24/h13H,4-12,14-18H2,1-3H3,(H-,22,23,24)/b19-13- |
| InChIKey | PYKHMVAPOMWNQV-UYRXBGFRSA-N |
| XLogP | 3.96 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|