C21H41NO3 — CID 177384303
2-[[(Z)-2-hydroxyoct-2-enyl]-dipentylazaniumyl]propanoate (PubChem CID 177384303) has the molecular formula C21H41NO3 and a molecular weight of 355.56 g/mol. Its IUPAC name is 2-[[(Z)-2-hydroxyoct-2-enyl]-dipentylazaniumyl]propanoate.
| Compound Name | 2-[[(Z)-2-hydroxyoct-2-enyl]-dipentylazaniumyl]propanoate |
|---|---|
| PubChem CID | 177384303 |
| Molecular Formula | C21H41NO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | 2-[[(Z)-2-hydroxyoct-2-enyl]-dipentylazaniumyl]propanoate |
| SMILES | CCCCC/C=C(\O)C[N+](CCCCC)(CCCCC)C(C)C(=O)[O-] |
| InChI | InChI=1S/C21H41NO3/c1-5-8-11-12-15-20(23)18-22(16-13-9-6-2,17-14-10-7-3)19(4)21(24)25/h15,19H,5-14,16-18H2,1-4H3,(H-,23,24,25)/b20-15- |
| InChIKey | RKQXYGLUUFNWIE-HKWRFOASSA-N |
| XLogP | 4.34 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|