C21H39NO5 — CID 177442494
2-[2-hydroxyethyl-bis[(Z)-2-hydroxyoct-2-enyl]azaniumyl]propanoate (PubChem CID 177442494) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-bis[(Z)-2-hydroxyoct-2-enyl]azaniumyl]propanoate.
| Compound Name | 2-[2-hydroxyethyl-bis[(Z)-2-hydroxyoct-2-enyl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 177442494 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 2-[2-hydroxyethyl-bis[(Z)-2-hydroxyoct-2-enyl]azaniumyl]propanoate |
| SMILES | CCCCC/C=C(\O)C[N+](CCO)(C/C(O)=C/CCCCC)C(C)C(=O)[O-] |
| InChI | InChI=1S/C21H39NO5/c1-4-6-8-10-12-19(24)16-22(14-15-23,18(3)21(26)27)17-20(25)13-11-9-7-5-2/h12-13,18,23H,4-11,14-17H2,1-3H3,(H2-,24,25,26,27)/b19-12-,20-13- |
| InChIKey | QVBWTGSXRWHPLO-YXZJEIOKSA-N |
| XLogP | 2.98 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|