C22H42NO5+ — CID 101276057
1-carboxypropyl-(2-hydroxyethyl)-bis[(Z)-2-hydroxyoct-2-enyl]azanium (PubChem CID 101276057) has the molecular formula C22H42NO5+ and a molecular weight of 400.58 g/mol. Its IUPAC name is 1-carboxypropyl-(2-hydroxyethyl)-bis[(Z)-2-hydroxyoct-2-enyl]azanium.
| Compound Name | 1-carboxypropyl-(2-hydroxyethyl)-bis[(Z)-2-hydroxyoct-2-enyl]azanium |
|---|---|
| PubChem CID | 101276057 |
| Molecular Formula | C22H42NO5+ |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 1-carboxypropyl-(2-hydroxyethyl)-bis[(Z)-2-hydroxyoct-2-enyl]azanium |
| SMILES | CCCCC/C=C(\O)C[N+](CCO)(C/C(O)=C/CCCCC)C(CC)C(=O)O |
| InChI | InChI=1S/C22H41NO5/c1-4-7-9-11-13-19(25)17-23(15-16-24,21(6-3)22(27)28)18-20(26)14-12-10-8-5-2/h13-14,21,24H,4-12,15-18H2,1-3H3,(H2-,25,26,27,28)/p+1/b19-13-,20-14- |
| InChIKey | LDLUFMSCLAFQNU-AXPXABNXSA-O |
| XLogP | 4.70 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|