C15H26O6 — CID 101278522
(E)-2-[2-(2,3-dihydroxypropoxy)-2-oxoethyl]dec-5-enoic acid (PubChem CID 101278522) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (E)-2-[2-(2,3-dihydroxypropoxy)-2-oxoethyl]dec-5-enoic acid.
| Compound Name | (E)-2-[2-(2,3-dihydroxypropoxy)-2-oxoethyl]dec-5-enoic acid |
|---|---|
| PubChem CID | 101278522 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (E)-2-[2-(2,3-dihydroxypropoxy)-2-oxoethyl]dec-5-enoic acid |
| SMILES | CCCC/C=C/CCC(CC(=O)OCC(O)CO)C(=O)O |
| InChI | InChI=1S/C15H26O6/c1-2-3-4-5-6-7-8-12(15(19)20)9-14(18)21-11-13(17)10-16/h5-6,12-13,16-17H,2-4,7-11H2,1H3,(H,19,20)/b6-5+ |
| InChIKey | MLDMBORIEZLQIE-AATRIKPKSA-N |
| XLogP | 1.50 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|