C18H34NO4S+ — CID 101286679
(2-hydroxy-3-sulfopropyl)-tris[(E)-pent-1-enyl]azanium (PubChem CID 101286679) has the molecular formula C18H34NO4S+ and a molecular weight of 360.54 g/mol. Its IUPAC name is (2-hydroxy-3-sulfopropyl)-tris[(E)-pent-1-enyl]azanium.
| Compound Name | (2-hydroxy-3-sulfopropyl)-tris[(E)-pent-1-enyl]azanium |
|---|---|
| PubChem CID | 101286679 |
| Molecular Formula | C18H34NO4S+ |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (2-hydroxy-3-sulfopropyl)-tris[(E)-pent-1-enyl]azanium |
| SMILES | CCC/C=C/[N+](/C=C/CCC)(/C=C/CCC)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C18H33NO4S/c1-4-7-10-13-19(14-11-8-5-2,15-12-9-6-3)16-18(20)17-24(21,22)23/h10-15,18,20H,4-9,16-17H2,1-3H3/p+1/b13-10+,14-11+,15-12+ |
| InChIKey | NOGFNYBTKNWEER-DZURWXOBSA-O |
| XLogP | 3.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|