C21H21NO8 — CID 101287933
tetramethyl 8-methyl-8-azatricyclo[7.2.2.02,7]trideca-2,4,6,10,12-pentaene-10,11,12,13-tetracarboxylate (PubChem CID 101287933) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is tetramethyl 8-methyl-8-azatricyclo[7.2.2.02,7]trideca-2,4,6,10,12-pentaene-10,11,12,13-tetracarboxylate.
| Compound Name | tetramethyl 8-methyl-8-azatricyclo[7.2.2.02,7]trideca-2,4,6,10,12-pentaene-10,11,12,13-tetracarboxylate |
|---|---|
| PubChem CID | 101287933 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | tetramethyl 8-methyl-8-azatricyclo[7.2.2.02,7]trideca-2,4,6,10,12-pentaene-10,11,12,13-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C(C(=O)OC)=C(C(=O)OC)C1c1ccccc1N2C |
| InChI | InChI=1S/C21H21NO8/c1-22-11-9-7-6-8-10(11)12-13(18(23)27-2)15(20(25)29-4)17(22)16(21(26)30-5)14(12)19(24)28-3/h6-9,12,17H,1-5H3 |
| InChIKey | VUSBYKXBYAETBG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|