C18H19NO4 — CID 134837038
methyl (1E,4aR)-1-(2-methoxy-2-oxoethylidene)-2,3,4,4a-tetrahydrobenzo[c]quinolizine-2-carboxylate (PubChem CID 134837038) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl (1E,4aR)-1-(2-methoxy-2-oxoethylidene)-2,3,4,4a-tetrahydrobenzo[c]quinolizine-2-carboxylate.
| Compound Name | methyl (1E,4aR)-1-(2-methoxy-2-oxoethylidene)-2,3,4,4a-tetrahydrobenzo[c]quinolizine-2-carboxylate |
|---|---|
| PubChem CID | 134837038 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl (1E,4aR)-1-(2-methoxy-2-oxoethylidene)-2,3,4,4a-tetrahydrobenzo[c]quinolizine-2-carboxylate |
| SMILES | COC(=O)/C=C1\C(C(=O)OC)CC[C@@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C18H19NO4/c1-22-17(20)11-16-14(18(21)23-2)10-9-13-8-7-12-5-3-4-6-15(12)19(13)16/h3-8,11,13-14H,9-10H2,1-2H3/b16-11+/t13-,14?/m0/s1 |
| InChIKey | OFYXVSDHOOUWJY-ZBSXHGKUSA-N |
| XLogP | 2.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|